C15H20ClN3OS — CID 56792918
2-[benzyl-[(5-chlorothiadiazol-4-yl)methyl]amino]-3-methylbutan-1-ol (PubChem CID 56792918) has the molecular formula C15H20ClN3OS and a molecular weight of 325.87 g/mol. Its IUPAC name is 2-[benzyl-[(5-chlorothiadiazol-4-yl)methyl]amino]-3-methylbutan-1-ol.
| Compound Name | 2-[benzyl-[(5-chlorothiadiazol-4-yl)methyl]amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 56792918 |
| Molecular Formula | C15H20ClN3OS |
| Molecular Weight | 325.87 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-[benzyl-[(5-chlorothiadiazol-4-yl)methyl]amino]-3-methylbutan-1-ol |
| SMILES | CC(C)C(CO)N(Cc1ccccc1)Cc1nnsc1Cl |
| InChI | InChI=1S/C15H20ClN3OS/c1-11(2)14(10-20)19(8-12-6-4-3-5-7-12)9-13-15(16)21-18-17-13/h3-7,11,14,20H,8-10H2,1-2H3 |
| InChIKey | RJFBKQJNFQTYTI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.87 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |