About tert-butyl N-[[1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate
tert-butyl N-[[1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate (PubChem CID 56793236) has the molecular formula C18H31N3O3
and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl N-[[1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate |
| PubChem CID | 56793236 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | tert-butyl N-[[1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(CC1CCCN(Cc2ccon2)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31N3O3/c1-14(2)21(17(22)24-18(3,4)5)12-15-7-6-9-20(11-15)13-16-8-10-23-19-16/h8,10,14-15H,6-7,9,11-13H2,1-5H3 |
| InChIKey | PCTPRUDZMQQVMT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[[1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate?
The IUPAC name of tert-butyl N-[[1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate (CID 56793236) is tert-butyl N-[[1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate.
What is the SMILES notation for tert-butyl N-[[1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate?
The canonical SMILES for tert-butyl N-[[1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate is CC(C)N(CC1CCCN(Cc2ccon2)C1)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[[1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate?
The InChIKey is PCTPRUDZMQQVMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N3O3/c1-14(2)21(17(22)24-18(3,4)5)12-15-7-6-9-20(11-15)13-16-8-10-23-19-16/h8,10,14-15H,6-7,9,11-13H2,1-5H3.
What are the key properties of tert-butyl N-[[1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate?
tert-butyl N-[[1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate has a molecular weight of 337.46 g/mol, XLogP of 3.53, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[1-(1,2-oxazol-3-ylmethyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate is sourced from PubChem (CID 56793236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).