About N-(2-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-2-carboxamide
N-(2-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-2-carboxamide (PubChem CID 56793426) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is N-(2-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | N-(2-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-2-carboxamide |
| PubChem CID | 56793426 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N-(2-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-2-carboxamide |
| SMILES | CC(C)(C)CC(O)CNC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C12H20N2O2/c1-12(2,3)7-9(15)8-14-11(16)10-5-4-6-13-10/h4-6,9,13,15H,7-8H2,1-3H3,(H,14,16) |
| InChIKey | MEBUIUALSJISHJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-2-carboxamide?
The IUPAC name of N-(2-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-2-carboxamide (CID 56793426) is N-(2-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-2-carboxamide.
What is the SMILES notation for N-(2-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-2-carboxamide?
The canonical SMILES for N-(2-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-2-carboxamide is CC(C)(C)CC(O)CNC(=O)c1ccc[nH]1.
What is the InChIKey of N-(2-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-2-carboxamide?
The InChIKey is MEBUIUALSJISHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2/c1-12(2,3)7-9(15)8-14-11(16)10-5-4-6-13-10/h4-6,9,13,15H,7-8H2,1-3H3,(H,14,16).
What are the key properties of N-(2-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-2-carboxamide?
N-(2-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-2-carboxamide has a molecular weight of 224.30 g/mol, XLogP of 1.54, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 56793426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).