C15H17ClN2O2 — CID 56793477
4-chloro-2-[3-(1,3-dioxolan-2-yl)piperidin-1-yl]benzonitrile (PubChem CID 56793477) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 4-chloro-2-[3-(1,3-dioxolan-2-yl)piperidin-1-yl]benzonitrile.
| Compound Name | 4-chloro-2-[3-(1,3-dioxolan-2-yl)piperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 56793477 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-chloro-2-[3-(1,3-dioxolan-2-yl)piperidin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(Cl)cc1N1CCCC(C2OCCO2)C1 |
| InChI | InChI=1S/C15H17ClN2O2/c16-13-4-3-11(9-17)14(8-13)18-5-1-2-12(10-18)15-19-6-7-20-15/h3-4,8,12,15H,1-2,5-7,10H2 |
| InChIKey | XXTFNJISHPZYEY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |