C14H17F4NO2 — CID 56793605
N-[2-(3-fluorophenyl)propan-2-yl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 56793605) has the molecular formula C14H17F4NO2 and a molecular weight of 307.29 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)propan-2-yl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[2-(3-fluorophenyl)propan-2-yl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 56793605 |
| Molecular Formula | C14H17F4NO2 |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-[2-(3-fluorophenyl)propan-2-yl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CC(C)(NC(=O)CCOCC(F)(F)F)c1cccc(F)c1 |
| InChI | InChI=1S/C14H17F4NO2/c1-13(2,10-4-3-5-11(15)8-10)19-12(20)6-7-21-9-14(16,17)18/h3-5,8H,6-7,9H2,1-2H3,(H,19,20) |
| InChIKey | CGAJIAKPZDNCGZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|