About 6-[3-(1,2,4-triazol-1-yl)phenoxy]tetrazolo[1,5-b]pyridazine
6-[3-(1,2,4-triazol-1-yl)phenoxy]tetrazolo[1,5-b]pyridazine (PubChem CID 56793666) has the molecular formula C12H8N8O
and a molecular weight of 280.25 g/mol. Its IUPAC name is 6-[3-(1,2,4-triazol-1-yl)phenoxy]tetrazolo[1,5-b]pyridazine.
Molecular Properties
| Compound Name | 6-[3-(1,2,4-triazol-1-yl)phenoxy]tetrazolo[1,5-b]pyridazine |
| PubChem CID | 56793666 |
| Molecular Formula | C12H8N8O |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 6-[3-(1,2,4-triazol-1-yl)phenoxy]tetrazolo[1,5-b]pyridazine |
| SMILES | c1cc(Oc2ccc3nnnn3n2)cc(-n2cncn2)c1 |
| InChI | InChI=1S/C12H8N8O/c1-2-9(19-8-13-7-14-19)6-10(3-1)21-12-5-4-11-15-17-18-20(11)16-12/h1-8H |
| InChIKey | ZHZBLUMPWLJEMF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 95.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 6-[3-(1,2,4-triazol-1-yl)phenoxy]tetrazolo[1,5-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(1,2,4-triazol-1-yl)phenoxy]tetrazolo[1,5-b]pyridazine?
The IUPAC name of 6-[3-(1,2,4-triazol-1-yl)phenoxy]tetrazolo[1,5-b]pyridazine (CID 56793666) is 6-[3-(1,2,4-triazol-1-yl)phenoxy]tetrazolo[1,5-b]pyridazine.
What is the SMILES notation for 6-[3-(1,2,4-triazol-1-yl)phenoxy]tetrazolo[1,5-b]pyridazine?
The canonical SMILES for 6-[3-(1,2,4-triazol-1-yl)phenoxy]tetrazolo[1,5-b]pyridazine is c1cc(Oc2ccc3nnnn3n2)cc(-n2cncn2)c1.
What is the InChIKey of 6-[3-(1,2,4-triazol-1-yl)phenoxy]tetrazolo[1,5-b]pyridazine?
The InChIKey is ZHZBLUMPWLJEMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N8O/c1-2-9(19-8-13-7-14-19)6-10(3-1)21-12-5-4-11-15-17-18-20(11)16-12/h1-8H.
What are the key properties of 6-[3-(1,2,4-triazol-1-yl)phenoxy]tetrazolo[1,5-b]pyridazine?
6-[3-(1,2,4-triazol-1-yl)phenoxy]tetrazolo[1,5-b]pyridazine has a molecular weight of 280.25 g/mol, XLogP of 0.89, 3 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(1,2,4-triazol-1-yl)phenoxy]tetrazolo[1,5-b]pyridazine is sourced from PubChem (CID 56793666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).