About 4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide
4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide (PubChem CID 56793697) has the molecular formula C13H19FN2O2S
and a molecular weight of 286.37 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide |
| PubChem CID | 56793697 |
| Molecular Formula | C13H19FN2O2S |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide |
| SMILES | CC1CC(c2ccc(F)cc2)CN1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C13H19FN2O2S/c1-10-8-12(11-4-6-13(14)7-5-11)9-16(10)19(17,18)15(2)3/h4-7,10,12H,8-9H2,1-3H3 |
| InChIKey | GUXTXYTVRQHKNX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide?
The IUPAC name of 4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide (CID 56793697) is 4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide.
What is the SMILES notation for 4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide?
The canonical SMILES for 4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide is CC1CC(c2ccc(F)cc2)CN1S(=O)(=O)N(C)C.
What is the InChIKey of 4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide?
The InChIKey is GUXTXYTVRQHKNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19FN2O2S/c1-10-8-12(11-4-6-13(14)7-5-11)9-16(10)19(17,18)15(2)3/h4-7,10,12H,8-9H2,1-3H3.
What are the key properties of 4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide?
4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide has a molecular weight of 286.37 g/mol, XLogP of 1.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide is sourced from PubChem (CID 56793697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).