About 1-(5,6-dimethylpyridazin-3-yl)oxy-3-(thiophen-2-ylmethoxy)propan-2-ol
1-(5,6-dimethylpyridazin-3-yl)oxy-3-(thiophen-2-ylmethoxy)propan-2-ol (PubChem CID 56794107) has the molecular formula C14H18N2O3S
and a molecular weight of 294.38 g/mol. Its IUPAC name is 1-(5,6-dimethylpyridazin-3-yl)oxy-3-(thiophen-2-ylmethoxy)propan-2-ol.
Molecular Properties
| Compound Name | 1-(5,6-dimethylpyridazin-3-yl)oxy-3-(thiophen-2-ylmethoxy)propan-2-ol |
| PubChem CID | 56794107 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-(5,6-dimethylpyridazin-3-yl)oxy-3-(thiophen-2-ylmethoxy)propan-2-ol |
| SMILES | Cc1cc(OCC(O)COCc2cccs2)nnc1C |
| InChI | InChI=1S/C14H18N2O3S/c1-10-6-14(16-15-11(10)2)19-8-12(17)7-18-9-13-4-3-5-20-13/h3-6,12,17H,7-9H2,1-2H3 |
| InChIKey | ZLESIMMFXPFACI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(5,6-dimethylpyridazin-3-yl)oxy-3-(thiophen-2-ylmethoxy)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,6-dimethylpyridazin-3-yl)oxy-3-(thiophen-2-ylmethoxy)propan-2-ol?
The IUPAC name of 1-(5,6-dimethylpyridazin-3-yl)oxy-3-(thiophen-2-ylmethoxy)propan-2-ol (CID 56794107) is 1-(5,6-dimethylpyridazin-3-yl)oxy-3-(thiophen-2-ylmethoxy)propan-2-ol.
What is the SMILES notation for 1-(5,6-dimethylpyridazin-3-yl)oxy-3-(thiophen-2-ylmethoxy)propan-2-ol?
The canonical SMILES for 1-(5,6-dimethylpyridazin-3-yl)oxy-3-(thiophen-2-ylmethoxy)propan-2-ol is Cc1cc(OCC(O)COCc2cccs2)nnc1C.
What is the InChIKey of 1-(5,6-dimethylpyridazin-3-yl)oxy-3-(thiophen-2-ylmethoxy)propan-2-ol?
The InChIKey is ZLESIMMFXPFACI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3S/c1-10-6-14(16-15-11(10)2)19-8-12(17)7-18-9-13-4-3-5-20-13/h3-6,12,17H,7-9H2,1-2H3.
What are the key properties of 1-(5,6-dimethylpyridazin-3-yl)oxy-3-(thiophen-2-ylmethoxy)propan-2-ol?
1-(5,6-dimethylpyridazin-3-yl)oxy-3-(thiophen-2-ylmethoxy)propan-2-ol has a molecular weight of 294.38 g/mol, XLogP of 2.11, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,6-dimethylpyridazin-3-yl)oxy-3-(thiophen-2-ylmethoxy)propan-2-ol is sourced from PubChem (CID 56794107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).