About 1-(oxan-4-ylsulfonyl)spiro[2H-indole-3,1'-cyclopropane]
1-(oxan-4-ylsulfonyl)spiro[2H-indole-3,1'-cyclopropane] (PubChem CID 56794326) has the molecular formula C15H19NO3S
and a molecular weight of 293.39 g/mol. Its IUPAC name is 1-(oxan-4-ylsulfonyl)spiro[2H-indole-3,1'-cyclopropane].
Molecular Properties
| Compound Name | 1-(oxan-4-ylsulfonyl)spiro[2H-indole-3,1'-cyclopropane] |
| PubChem CID | 56794326 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 1-(oxan-4-ylsulfonyl)spiro[2H-indole-3,1'-cyclopropane] |
| SMILES | O=S(=O)(C1CCOCC1)N1CC2(CC2)c2ccccc21 |
| InChI | InChI=1S/C15H19NO3S/c17-20(18,12-5-9-19-10-6-12)16-11-15(7-8-15)13-3-1-2-4-14(13)16/h1-4,12H,5-11H2 |
| InChIKey | JYOUGIMZDSKRNI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(oxan-4-ylsulfonyl)spiro[2H-indole-3,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxan-4-ylsulfonyl)spiro[2H-indole-3,1'-cyclopropane]?
The IUPAC name of 1-(oxan-4-ylsulfonyl)spiro[2H-indole-3,1'-cyclopropane] (CID 56794326) is 1-(oxan-4-ylsulfonyl)spiro[2H-indole-3,1'-cyclopropane].
What is the SMILES notation for 1-(oxan-4-ylsulfonyl)spiro[2H-indole-3,1'-cyclopropane]?
The canonical SMILES for 1-(oxan-4-ylsulfonyl)spiro[2H-indole-3,1'-cyclopropane] is O=S(=O)(C1CCOCC1)N1CC2(CC2)c2ccccc21.
What is the InChIKey of 1-(oxan-4-ylsulfonyl)spiro[2H-indole-3,1'-cyclopropane]?
The InChIKey is JYOUGIMZDSKRNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO3S/c17-20(18,12-5-9-19-10-6-12)16-11-15(7-8-15)13-3-1-2-4-14(13)16/h1-4,12H,5-11H2.
What are the key properties of 1-(oxan-4-ylsulfonyl)spiro[2H-indole-3,1'-cyclopropane]?
1-(oxan-4-ylsulfonyl)spiro[2H-indole-3,1'-cyclopropane] has a molecular weight of 293.39 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxan-4-ylsulfonyl)spiro[2H-indole-3,1'-cyclopropane] is sourced from PubChem (CID 56794326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).