C11H20F3NO — CID 56794360
2-cyclohexyl-2-(2,2,2-trifluoroethylamino)propan-1-ol (PubChem CID 56794360) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-cyclohexyl-2-(2,2,2-trifluoroethylamino)propan-1-ol.
| Compound Name | 2-cyclohexyl-2-(2,2,2-trifluoroethylamino)propan-1-ol |
|---|---|
| PubChem CID | 56794360 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-cyclohexyl-2-(2,2,2-trifluoroethylamino)propan-1-ol |
| SMILES | CC(CO)(NCC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C11H20F3NO/c1-10(8-16,15-7-11(12,13)14)9-5-3-2-4-6-9/h9,15-16H,2-8H2,1H3 |
| InChIKey | GRSQSJYUSFJGHP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |