C18H30N4O2 — CID 56794680
N-[3-[[2-(dimethylamino)-3-ethylpentyl]carbamoylamino]phenyl]acetamide (PubChem CID 56794680) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is N-[3-[[2-(dimethylamino)-3-ethylpentyl]carbamoylamino]phenyl]acetamide.
| Compound Name | N-[3-[[2-(dimethylamino)-3-ethylpentyl]carbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 56794680 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | N-[3-[[2-(dimethylamino)-3-ethylpentyl]carbamoylamino]phenyl]acetamide |
| SMILES | CCC(CC)C(CNC(=O)Nc1cccc(NC(C)=O)c1)N(C)C |
| InChI | InChI=1S/C18H30N4O2/c1-6-14(7-2)17(22(4)5)12-19-18(24)21-16-10-8-9-15(11-16)20-13(3)23/h8-11,14,17H,6-7,12H2,1-5H3,(H,20,23)(H2,19,21,24) |
| InChIKey | FGNAAPCOBXMMSG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |