About N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N-methyl-1-phenylpyrazole-4-carboxamide
N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N-methyl-1-phenylpyrazole-4-carboxamide (PubChem CID 56794881) has the molecular formula C19H23N3O2
and a molecular weight of 325.41 g/mol. Its IUPAC name is N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N-methyl-1-phenylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N-methyl-1-phenylpyrazole-4-carboxamide |
| PubChem CID | 56794881 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N-methyl-1-phenylpyrazole-4-carboxamide |
| SMILES | CN(C(=O)c1cnn(-c2ccccc2)c1)C1C2CCOC2C1(C)C |
| InChI | InChI=1S/C19H23N3O2/c1-19(2)16(15-9-10-24-17(15)19)21(3)18(23)13-11-20-22(12-13)14-7-5-4-6-8-14/h4-8,11-12,15-17H,9-10H2,1-3H3 |
| InChIKey | QELHMOYIGADMQD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N-methyl-1-phenylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N-methyl-1-phenylpyrazole-4-carboxamide?
The IUPAC name of N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N-methyl-1-phenylpyrazole-4-carboxamide (CID 56794881) is N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N-methyl-1-phenylpyrazole-4-carboxamide.
What is the SMILES notation for N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N-methyl-1-phenylpyrazole-4-carboxamide?
The canonical SMILES for N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N-methyl-1-phenylpyrazole-4-carboxamide is CN(C(=O)c1cnn(-c2ccccc2)c1)C1C2CCOC2C1(C)C.
What is the InChIKey of N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N-methyl-1-phenylpyrazole-4-carboxamide?
The InChIKey is QELHMOYIGADMQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O2/c1-19(2)16(15-9-10-24-17(15)19)21(3)18(23)13-11-20-22(12-13)14-7-5-4-6-8-14/h4-8,11-12,15-17H,9-10H2,1-3H3.
What are the key properties of N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N-methyl-1-phenylpyrazole-4-carboxamide?
N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N-methyl-1-phenylpyrazole-4-carboxamide has a molecular weight of 325.41 g/mol, XLogP of 2.76, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N-methyl-1-phenylpyrazole-4-carboxamide is sourced from PubChem (CID 56794881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).