About 6-[2-(3,4-difluorophenyl)-2-hydroxyethyl]pyrido[2,3-d]pyridazin-5-one
6-[2-(3,4-difluorophenyl)-2-hydroxyethyl]pyrido[2,3-d]pyridazin-5-one (PubChem CID 56795006) has the molecular formula C15H11F2N3O2
and a molecular weight of 303.27 g/mol. Its IUPAC name is 6-[2-(3,4-difluorophenyl)-2-hydroxyethyl]pyrido[2,3-d]pyridazin-5-one.
Molecular Properties
| Compound Name | 6-[2-(3,4-difluorophenyl)-2-hydroxyethyl]pyrido[2,3-d]pyridazin-5-one |
| PubChem CID | 56795006 |
| Molecular Formula | C15H11F2N3O2 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 6-[2-(3,4-difluorophenyl)-2-hydroxyethyl]pyrido[2,3-d]pyridazin-5-one |
| SMILES | O=c1c2cccnc2cnn1CC(O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H11F2N3O2/c16-11-4-3-9(6-12(11)17)14(21)8-20-15(22)10-2-1-5-18-13(10)7-19-20/h1-7,14,21H,8H2 |
| InChIKey | CZKFKMOFCPVZDK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[2-(3,4-difluorophenyl)-2-hydroxyethyl]pyrido[2,3-d]pyridazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3,4-difluorophenyl)-2-hydroxyethyl]pyrido[2,3-d]pyridazin-5-one?
The IUPAC name of 6-[2-(3,4-difluorophenyl)-2-hydroxyethyl]pyrido[2,3-d]pyridazin-5-one (CID 56795006) is 6-[2-(3,4-difluorophenyl)-2-hydroxyethyl]pyrido[2,3-d]pyridazin-5-one.
What is the SMILES notation for 6-[2-(3,4-difluorophenyl)-2-hydroxyethyl]pyrido[2,3-d]pyridazin-5-one?
The canonical SMILES for 6-[2-(3,4-difluorophenyl)-2-hydroxyethyl]pyrido[2,3-d]pyridazin-5-one is O=c1c2cccnc2cnn1CC(O)c1ccc(F)c(F)c1.
What is the InChIKey of 6-[2-(3,4-difluorophenyl)-2-hydroxyethyl]pyrido[2,3-d]pyridazin-5-one?
The InChIKey is CZKFKMOFCPVZDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F2N3O2/c16-11-4-3-9(6-12(11)17)14(21)8-20-15(22)10-2-1-5-18-13(10)7-19-20/h1-7,14,21H,8H2.
What are the key properties of 6-[2-(3,4-difluorophenyl)-2-hydroxyethyl]pyrido[2,3-d]pyridazin-5-one?
6-[2-(3,4-difluorophenyl)-2-hydroxyethyl]pyrido[2,3-d]pyridazin-5-one has a molecular weight of 303.27 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3,4-difluorophenyl)-2-hydroxyethyl]pyrido[2,3-d]pyridazin-5-one is sourced from PubChem (CID 56795006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).