C16H9ClN4O2 — CID 56795629
10-chloro-3-phenyl-7H-[1,2,4]triazino[2,3-c]quinazoline-2,6-dione (PubChem CID 56795629) has the molecular formula C16H9ClN4O2 and a molecular weight of 324.73 g/mol. Its IUPAC name is 10-chloro-3-phenyl-7H-[1,2,4]triazino[2,3-c]quinazoline-2,6-dione.
| Compound Name | 10-chloro-3-phenyl-7H-[1,2,4]triazino[2,3-c]quinazoline-2,6-dione |
|---|---|
| PubChem CID | 56795629 |
| Molecular Formula | C16H9ClN4O2 |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 10-chloro-3-phenyl-7H-[1,2,4]triazino[2,3-c]quinazoline-2,6-dione |
| SMILES | O=c1nc2c3cc(Cl)ccc3[nH]c(=O)n2nc1-c1ccccc1 |
| InChI | InChI=1S/C16H9ClN4O2/c17-10-6-7-12-11(8-10)14-19-15(22)13(9-4-2-1-3-5-9)20-21(14)16(23)18-12/h1-8H,(H,18,23) |
| InChIKey | RKESIFLIMOBORL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|