C16H23N3O4 — CID 56795920
4-[[(2-methoxyphenyl)methylcarbamoylamino]methyl]oxane-4-carboxamide (PubChem CID 56795920) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-[[(2-methoxyphenyl)methylcarbamoylamino]methyl]oxane-4-carboxamide.
| Compound Name | 4-[[(2-methoxyphenyl)methylcarbamoylamino]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 56795920 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 4-[[(2-methoxyphenyl)methylcarbamoylamino]methyl]oxane-4-carboxamide |
| SMILES | COc1ccccc1CNC(=O)NCC1(C(N)=O)CCOCC1 |
| InChI | InChI=1S/C16H23N3O4/c1-22-13-5-3-2-4-12(13)10-18-15(21)19-11-16(14(17)20)6-8-23-9-7-16/h2-5H,6-11H2,1H3,(H2,17,20)(H2,18,19,21) |
| InChIKey | KXSTWRHZQFCOJX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |