C17H25N3O3 — CID 56796668
1-[2-[[3-(methoxymethyl)phenyl]methylamino]-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 56796668) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-[2-[[3-(methoxymethyl)phenyl]methylamino]-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[[3-(methoxymethyl)phenyl]methylamino]-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56796668 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-[2-[[3-(methoxymethyl)phenyl]methylamino]-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | COCc1cccc(CNC(=O)CN2CCC(C(N)=O)CC2)c1 |
| InChI | InChI=1S/C17H25N3O3/c1-23-12-14-4-2-3-13(9-14)10-19-16(21)11-20-7-5-15(6-8-20)17(18)22/h2-4,9,15H,5-8,10-12H2,1H3,(H2,18,22)(H,19,21) |
| InChIKey | SMIAPCWVOYBRDY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |