C7H11BrN2O2 — CID 567967
5-(4-bromobutyl)imidazolidine-2,4-dione (PubChem CID 567967) has the molecular formula C7H11BrN2O2 and a molecular weight of 235.08 g/mol. Its IUPAC name is 5-(4-bromobutyl)imidazolidine-2,4-dione.
| Compound Name | 5-(4-bromobutyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 567967 |
| Molecular Formula | C7H11BrN2O2 |
| Molecular Weight | 235.08 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 5-(4-bromobutyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CCCCBr)N1 |
| InChI | InChI=1S/C7H11BrN2O2/c8-4-2-1-3-5-6(11)10-7(12)9-5/h5H,1-4H2,(H2,9,10,11,12) |
| InChIKey | TWRKXHFCQVEYHI-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.08 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|