About 1,3-dimethyl-2,4-dioxo-6-[(2-oxo-2-piperidin-1-ylethyl)amino]pyrimidine-5-carbonitrile
1,3-dimethyl-2,4-dioxo-6-[(2-oxo-2-piperidin-1-ylethyl)amino]pyrimidine-5-carbonitrile (PubChem CID 56796800) has the molecular formula C14H19N5O3
and a molecular weight of 305.34 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dioxo-6-[(2-oxo-2-piperidin-1-ylethyl)amino]pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 1,3-dimethyl-2,4-dioxo-6-[(2-oxo-2-piperidin-1-ylethyl)amino]pyrimidine-5-carbonitrile |
| PubChem CID | 56796800 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 1,3-dimethyl-2,4-dioxo-6-[(2-oxo-2-piperidin-1-ylethyl)amino]pyrimidine-5-carbonitrile |
| SMILES | Cn1c(NCC(=O)N2CCCCC2)c(C#N)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H19N5O3/c1-17-12(10(8-15)13(21)18(2)14(17)22)16-9-11(20)19-6-4-3-5-7-19/h16H,3-7,9H2,1-2H3 |
| InChIKey | RKALTKXGCGGDIB-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,3-dimethyl-2,4-dioxo-6-[(2-oxo-2-piperidin-1-ylethyl)amino]pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-2,4-dioxo-6-[(2-oxo-2-piperidin-1-ylethyl)amino]pyrimidine-5-carbonitrile?
The IUPAC name of 1,3-dimethyl-2,4-dioxo-6-[(2-oxo-2-piperidin-1-ylethyl)amino]pyrimidine-5-carbonitrile (CID 56796800) is 1,3-dimethyl-2,4-dioxo-6-[(2-oxo-2-piperidin-1-ylethyl)amino]pyrimidine-5-carbonitrile.
What is the SMILES notation for 1,3-dimethyl-2,4-dioxo-6-[(2-oxo-2-piperidin-1-ylethyl)amino]pyrimidine-5-carbonitrile?
The canonical SMILES for 1,3-dimethyl-2,4-dioxo-6-[(2-oxo-2-piperidin-1-ylethyl)amino]pyrimidine-5-carbonitrile is Cn1c(NCC(=O)N2CCCCC2)c(C#N)c(=O)n(C)c1=O.
What is the InChIKey of 1,3-dimethyl-2,4-dioxo-6-[(2-oxo-2-piperidin-1-ylethyl)amino]pyrimidine-5-carbonitrile?
The InChIKey is RKALTKXGCGGDIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O3/c1-17-12(10(8-15)13(21)18(2)14(17)22)16-9-11(20)19-6-4-3-5-7-19/h16H,3-7,9H2,1-2H3.
What are the key properties of 1,3-dimethyl-2,4-dioxo-6-[(2-oxo-2-piperidin-1-ylethyl)amino]pyrimidine-5-carbonitrile?
1,3-dimethyl-2,4-dioxo-6-[(2-oxo-2-piperidin-1-ylethyl)amino]pyrimidine-5-carbonitrile has a molecular weight of 305.34 g/mol, XLogP of -0.62, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-2,4-dioxo-6-[(2-oxo-2-piperidin-1-ylethyl)amino]pyrimidine-5-carbonitrile is sourced from PubChem (CID 56796800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).