C18H27N5O2 — CID 56796911
1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-(4-pyrazin-2-ylpiperazin-1-yl)ethanone (PubChem CID 56796911) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-(4-pyrazin-2-ylpiperazin-1-yl)ethanone.
| Compound Name | 1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-(4-pyrazin-2-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 56796911 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-(4-pyrazin-2-ylpiperazin-1-yl)ethanone |
| SMILES | O=C(CN1CCN(c2cnccn2)CC1)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C18H27N5O2/c24-18(23-11-12-25-16-4-2-1-3-15(16)23)14-21-7-9-22(10-8-21)17-13-19-5-6-20-17/h5-6,13,15-16H,1-4,7-12,14H2 |
| InChIKey | TXFYJFXCCZFHPE-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |