About 5-[(6-chloro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid
5-[(6-chloro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid (PubChem CID 56797607) has the molecular formula C15H14ClNO4S2
and a molecular weight of 371.87 g/mol. Its IUPAC name is 5-[(6-chloro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(6-chloro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid |
| PubChem CID | 56797607 |
| Molecular Formula | C15H14ClNO4S2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 5-[(6-chloro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)N2CCCc3cc(Cl)ccc32)sc1C(=O)O |
| InChI | InChI=1S/C15H14ClNO4S2/c1-9-7-13(22-14(9)15(18)19)23(20,21)17-6-2-3-10-8-11(16)4-5-12(10)17/h4-5,7-8H,2-3,6H2,1H3,(H,18,19) |
| InChIKey | AFOLIFMODNWUPS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(6-chloro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-chloro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid?
The IUPAC name of 5-[(6-chloro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid (CID 56797607) is 5-[(6-chloro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid.
What is the SMILES notation for 5-[(6-chloro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid?
The canonical SMILES for 5-[(6-chloro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid is Cc1cc(S(=O)(=O)N2CCCc3cc(Cl)ccc32)sc1C(=O)O.
What is the InChIKey of 5-[(6-chloro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid?
The InChIKey is AFOLIFMODNWUPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClNO4S2/c1-9-7-13(22-14(9)15(18)19)23(20,21)17-6-2-3-10-8-11(16)4-5-12(10)17/h4-5,7-8H,2-3,6H2,1H3,(H,18,19).
What are the key properties of 5-[(6-chloro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid?
5-[(6-chloro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid has a molecular weight of 371.87 g/mol, XLogP of 3.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-chloro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid is sourced from PubChem (CID 56797607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).