About 5-[(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid
5-[(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid (PubChem CID 56797611) has the molecular formula C15H13F2NO4S2
and a molecular weight of 373.40 g/mol. Its IUPAC name is 5-[(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid |
| PubChem CID | 56797611 |
| Molecular Formula | C15H13F2NO4S2 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 5-[(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)N2CCCc3cc(F)cc(F)c32)sc1C(=O)O |
| InChI | InChI=1S/C15H13F2NO4S2/c1-8-5-12(23-14(8)15(19)20)24(21,22)18-4-2-3-9-6-10(16)7-11(17)13(9)18/h5-7H,2-4H2,1H3,(H,19,20) |
| InChIKey | HFYPSCDTZJGXEA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid?
The IUPAC name of 5-[(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid (CID 56797611) is 5-[(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid.
What is the SMILES notation for 5-[(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid?
The canonical SMILES for 5-[(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid is Cc1cc(S(=O)(=O)N2CCCc3cc(F)cc(F)c32)sc1C(=O)O.
What is the InChIKey of 5-[(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid?
The InChIKey is HFYPSCDTZJGXEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2NO4S2/c1-8-5-12(23-14(8)15(19)20)24(21,22)18-4-2-3-9-6-10(16)7-11(17)13(9)18/h5-7H,2-4H2,1H3,(H,19,20).
What are the key properties of 5-[(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid?
5-[(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid has a molecular weight of 373.40 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-3-methylthiophene-2-carboxylic acid is sourced from PubChem (CID 56797611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).