C13H17N5O4 — CID 56798783
5-[2-[3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 56798783) has the molecular formula C13H17N5O4 and a molecular weight of 307.31 g/mol. Its IUPAC name is 5-[2-[3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5-[2-[3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56798783 |
| Molecular Formula | C13H17N5O4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 5-[2-[3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | Cc1noc(C2CCCN(C(=O)CC3NC(=O)NC3=O)C2)n1 |
| InChI | InChI=1S/C13H17N5O4/c1-7-14-12(22-17-7)8-3-2-4-18(6-8)10(19)5-9-11(20)16-13(21)15-9/h8-9H,2-6H2,1H3,(H2,15,16,20,21) |
| InChIKey | HMCKDDMSAJEIHV-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|