C17H25N3O4 — CID 56798865
1-N-[3-(4-methoxyphenoxy)propyl]piperidine-1,4-dicarboxamide (PubChem CID 56798865) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-N-[3-(4-methoxyphenoxy)propyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[3-(4-methoxyphenoxy)propyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 56798865 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-N-[3-(4-methoxyphenoxy)propyl]piperidine-1,4-dicarboxamide |
| SMILES | COc1ccc(OCCCNC(=O)N2CCC(C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C17H25N3O4/c1-23-14-3-5-15(6-4-14)24-12-2-9-19-17(22)20-10-7-13(8-11-20)16(18)21/h3-6,13H,2,7-12H2,1H3,(H2,18,21)(H,19,22) |
| InChIKey | VIBWQSOQBXSQKH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|