C14H17N3O3 — CID 56799099
3-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propyl]imidazolidine-2,4-dione (PubChem CID 56799099) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56799099 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCCN1CCOc2ccccc21 |
| InChI | InChI=1S/C14H17N3O3/c18-13-10-15-14(19)17(13)7-3-6-16-8-9-20-12-5-2-1-4-11(12)16/h1-2,4-5H,3,6-10H2,(H,15,19) |
| InChIKey | OEWUFSKLXTXFLK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|