C20H30N2O4 — CID 56799349
tert-butyl 3-[4-[2-(4-methoxyphenyl)acetyl]piperazin-1-yl]propanoate (PubChem CID 56799349) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is tert-butyl 3-[4-[2-(4-methoxyphenyl)acetyl]piperazin-1-yl]propanoate.
| Compound Name | tert-butyl 3-[4-[2-(4-methoxyphenyl)acetyl]piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 56799349 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | tert-butyl 3-[4-[2-(4-methoxyphenyl)acetyl]piperazin-1-yl]propanoate |
| SMILES | COc1ccc(CC(=O)N2CCN(CCC(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H30N2O4/c1-20(2,3)26-19(24)9-10-21-11-13-22(14-12-21)18(23)15-16-5-7-17(25-4)8-6-16/h5-8H,9-15H2,1-4H3 |
| InChIKey | FAWDVOYMKNPDJP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |