C21H20N4O — CID 56799624
2-[2-[(4-phenylphenyl)methylamino]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 56799624) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-[2-[(4-phenylphenyl)methylamino]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[2-[(4-phenylphenyl)methylamino]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 56799624 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-[2-[(4-phenylphenyl)methylamino]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | O=c1n(CCNCc2ccc(-c3ccccc3)cc2)nc2ccccn12 |
| InChI | InChI=1S/C21H20N4O/c26-21-24-14-5-4-8-20(24)23-25(21)15-13-22-16-17-9-11-19(12-10-17)18-6-2-1-3-7-18/h1-12,14,22H,13,15-16H2 |
| InChIKey | UEEOXYQXFVQIGI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 51.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|