About 1,3-bis(morpholin-4-ylmethyl)-1,3-diazinan-2-one
1,3-bis(morpholin-4-ylmethyl)-1,3-diazinan-2-one (PubChem CID 567997) has the molecular formula C14H26N4O3
and a molecular weight of 298.39 g/mol. Its IUPAC name is 1,3-bis(morpholin-4-ylmethyl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1,3-bis(morpholin-4-ylmethyl)-1,3-diazinan-2-one |
| PubChem CID | 567997 |
| Molecular Formula | C14H26N4O3 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 1,3-bis(morpholin-4-ylmethyl)-1,3-diazinan-2-one |
| SMILES | O=C1N(CN2CCOCC2)CCCN1CN1CCOCC1 |
| InChI | InChI=1S/C14H26N4O3/c19-14-17(12-15-4-8-20-9-5-15)2-1-3-18(14)13-16-6-10-21-11-7-16/h1-13H2 |
| InChIKey | BKOXFDPFVMELRA-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 48.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-bis(morpholin-4-ylmethyl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(morpholin-4-ylmethyl)-1,3-diazinan-2-one?
The IUPAC name of 1,3-bis(morpholin-4-ylmethyl)-1,3-diazinan-2-one (CID 567997) is 1,3-bis(morpholin-4-ylmethyl)-1,3-diazinan-2-one.
What is the SMILES notation for 1,3-bis(morpholin-4-ylmethyl)-1,3-diazinan-2-one?
The canonical SMILES for 1,3-bis(morpholin-4-ylmethyl)-1,3-diazinan-2-one is O=C1N(CN2CCOCC2)CCCN1CN1CCOCC1.
What is the InChIKey of 1,3-bis(morpholin-4-ylmethyl)-1,3-diazinan-2-one?
The InChIKey is BKOXFDPFVMELRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N4O3/c19-14-17(12-15-4-8-20-9-5-15)2-1-3-18(14)13-16-6-10-21-11-7-16/h1-13H2.
What are the key properties of 1,3-bis(morpholin-4-ylmethyl)-1,3-diazinan-2-one?
1,3-bis(morpholin-4-ylmethyl)-1,3-diazinan-2-one has a molecular weight of 298.39 g/mol, XLogP of -0.31, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(morpholin-4-ylmethyl)-1,3-diazinan-2-one is sourced from PubChem (CID 567997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).