C12H19ClF3N3S — CID 56800148
N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]thiophene-2-carboximidamide;hydrochloride (PubChem CID 56800148) has the molecular formula C12H19ClF3N3S and a molecular weight of 329.82 g/mol. Its IUPAC name is N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]thiophene-2-carboximidamide;hydrochloride.
| Compound Name | N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]thiophene-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 56800148 |
| Molecular Formula | C12H19ClF3N3S |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]thiophene-2-carboximidamide;hydrochloride |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)c1cccs1.Cl |
| InChI | InChI=1S/C12H18F3N3S.ClH/c1-16-11(10-5-3-8-19-10)17-6-4-7-18(2)9-12(13,14)15;/h3,5,8H,4,6-7,9H2,1-2H3,(H,16,17);1H |
| InChIKey | RJTSKDVVSUGRSV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|