About N-(2,3-dihydro-1-benzofuran-3-yl)-3-nitroimidazo[1,2-a]pyridin-2-amine
N-(2,3-dihydro-1-benzofuran-3-yl)-3-nitroimidazo[1,2-a]pyridin-2-amine (PubChem CID 56800330) has the molecular formula C15H12N4O3
and a molecular weight of 296.29 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-3-yl)-3-nitroimidazo[1,2-a]pyridin-2-amine.
Molecular Properties
| Compound Name | N-(2,3-dihydro-1-benzofuran-3-yl)-3-nitroimidazo[1,2-a]pyridin-2-amine |
| PubChem CID | 56800330 |
| Molecular Formula | C15H12N4O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-3-yl)-3-nitroimidazo[1,2-a]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1c(NC2COc3ccccc32)nc2ccccn12 |
| InChI | InChI=1S/C15H12N4O3/c20-19(21)15-14(17-13-7-3-4-8-18(13)15)16-11-9-22-12-6-2-1-5-10(11)12/h1-8,11,16H,9H2 |
| InChIKey | SWMNAUWLFUYFAL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,3-dihydro-1-benzofuran-3-yl)-3-nitroimidazo[1,2-a]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydro-1-benzofuran-3-yl)-3-nitroimidazo[1,2-a]pyridin-2-amine?
The IUPAC name of N-(2,3-dihydro-1-benzofuran-3-yl)-3-nitroimidazo[1,2-a]pyridin-2-amine (CID 56800330) is N-(2,3-dihydro-1-benzofuran-3-yl)-3-nitroimidazo[1,2-a]pyridin-2-amine.
What is the SMILES notation for N-(2,3-dihydro-1-benzofuran-3-yl)-3-nitroimidazo[1,2-a]pyridin-2-amine?
The canonical SMILES for N-(2,3-dihydro-1-benzofuran-3-yl)-3-nitroimidazo[1,2-a]pyridin-2-amine is O=[N+]([O-])c1c(NC2COc3ccccc32)nc2ccccn12.
What is the InChIKey of N-(2,3-dihydro-1-benzofuran-3-yl)-3-nitroimidazo[1,2-a]pyridin-2-amine?
The InChIKey is SWMNAUWLFUYFAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4O3/c20-19(21)15-14(17-13-7-3-4-8-18(13)15)16-11-9-22-12-6-2-1-5-10(11)12/h1-8,11,16H,9H2.
What are the key properties of N-(2,3-dihydro-1-benzofuran-3-yl)-3-nitroimidazo[1,2-a]pyridin-2-amine?
N-(2,3-dihydro-1-benzofuran-3-yl)-3-nitroimidazo[1,2-a]pyridin-2-amine has a molecular weight of 296.29 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydro-1-benzofuran-3-yl)-3-nitroimidazo[1,2-a]pyridin-2-amine is sourced from PubChem (CID 56800330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).