About 2-(5-methoxy-2,3-dihydroindol-1-yl)-N-(1-phenylcyclobutyl)acetamide
2-(5-methoxy-2,3-dihydroindol-1-yl)-N-(1-phenylcyclobutyl)acetamide (PubChem CID 56800420) has the molecular formula C21H24N2O2
and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-(5-methoxy-2,3-dihydroindol-1-yl)-N-(1-phenylcyclobutyl)acetamide.
Molecular Properties
| Compound Name | 2-(5-methoxy-2,3-dihydroindol-1-yl)-N-(1-phenylcyclobutyl)acetamide |
| PubChem CID | 56800420 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-(5-methoxy-2,3-dihydroindol-1-yl)-N-(1-phenylcyclobutyl)acetamide |
| SMILES | COc1ccc2c(c1)CCN2CC(=O)NC1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C21H24N2O2/c1-25-18-8-9-19-16(14-18)10-13-23(19)15-20(24)22-21(11-5-12-21)17-6-3-2-4-7-17/h2-4,6-9,14H,5,10-13,15H2,1H3,(H,22,24) |
| InChIKey | XMHCRRSHLOUVIH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-methoxy-2,3-dihydroindol-1-yl)-N-(1-phenylcyclobutyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methoxy-2,3-dihydroindol-1-yl)-N-(1-phenylcyclobutyl)acetamide?
The IUPAC name of 2-(5-methoxy-2,3-dihydroindol-1-yl)-N-(1-phenylcyclobutyl)acetamide (CID 56800420) is 2-(5-methoxy-2,3-dihydroindol-1-yl)-N-(1-phenylcyclobutyl)acetamide.
What is the SMILES notation for 2-(5-methoxy-2,3-dihydroindol-1-yl)-N-(1-phenylcyclobutyl)acetamide?
The canonical SMILES for 2-(5-methoxy-2,3-dihydroindol-1-yl)-N-(1-phenylcyclobutyl)acetamide is COc1ccc2c(c1)CCN2CC(=O)NC1(c2ccccc2)CCC1.
What is the InChIKey of 2-(5-methoxy-2,3-dihydroindol-1-yl)-N-(1-phenylcyclobutyl)acetamide?
The InChIKey is XMHCRRSHLOUVIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O2/c1-25-18-8-9-19-16(14-18)10-13-23(19)15-20(24)22-21(11-5-12-21)17-6-3-2-4-7-17/h2-4,6-9,14H,5,10-13,15H2,1H3,(H,22,24).
What are the key properties of 2-(5-methoxy-2,3-dihydroindol-1-yl)-N-(1-phenylcyclobutyl)acetamide?
2-(5-methoxy-2,3-dihydroindol-1-yl)-N-(1-phenylcyclobutyl)acetamide has a molecular weight of 336.44 g/mol, XLogP of 3.25, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methoxy-2,3-dihydroindol-1-yl)-N-(1-phenylcyclobutyl)acetamide is sourced from PubChem (CID 56800420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).