C14H24N6O2 — CID 56802650
N-(2-acetamidoethyl)-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]acetamide (PubChem CID 56802650) has the molecular formula C14H24N6O2 and a molecular weight of 308.39 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 56802650 |
| Molecular Formula | C14H24N6O2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | N-(2-acetamidoethyl)-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]acetamide |
| SMILES | CC(=O)NCCNC(=O)CN1CCCC(Cn2cncn2)C1 |
| InChI | InChI=1S/C14H24N6O2/c1-12(21)16-4-5-17-14(22)9-19-6-2-3-13(7-19)8-20-11-15-10-18-20/h10-11,13H,2-9H2,1H3,(H,16,21)(H,17,22) |
| InChIKey | VYDPTSXAIMTGMP-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|