C14H18Cl2N6S — CID 56802843
N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine;hydrochloride (PubChem CID 56802843) has the molecular formula C14H18Cl2N6S and a molecular weight of 373.31 g/mol. Its IUPAC name is N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine;hydrochloride.
| Compound Name | N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine;hydrochloride |
|---|---|
| PubChem CID | 56802843 |
| Molecular Formula | C14H18Cl2N6S |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine;hydrochloride |
| SMILES | CCc1nc2n(n1)CC(NCc1c(Cl)nc3sccn13)CC2.Cl |
| InChI | InChI=1S/C14H17ClN6S.ClH/c1-2-11-17-12-4-3-9(8-21(12)19-11)16-7-10-13(15)18-14-20(10)5-6-22-14;/h5-6,9,16H,2-4,7-8H2,1H3;1H |
| InChIKey | ZMJCSUOOEGSYIV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 60.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |