C19H16ClFN2O2 — CID 56804028
2-[4-(3-chlorophenyl)oxan-4-yl]-5-(2-fluorophenyl)-1,3,4-oxadiazole (PubChem CID 56804028) has the molecular formula C19H16ClFN2O2 and a molecular weight of 358.80 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)oxan-4-yl]-5-(2-fluorophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[4-(3-chlorophenyl)oxan-4-yl]-5-(2-fluorophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 56804028 |
| Molecular Formula | C19H16ClFN2O2 |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-[4-(3-chlorophenyl)oxan-4-yl]-5-(2-fluorophenyl)-1,3,4-oxadiazole |
| SMILES | Fc1ccccc1-c1nnc(C2(c3cccc(Cl)c3)CCOCC2)o1 |
| InChI | InChI=1S/C19H16ClFN2O2/c20-14-5-3-4-13(12-14)19(8-10-24-11-9-19)18-23-22-17(25-18)15-6-1-2-7-16(15)21/h1-7,12H,8-11H2 |
| InChIKey | PNVZIZKKTYSHHK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |