About methyl 2-methylideneoctanoate
methyl 2-methylideneoctanoate (PubChem CID 568043) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is methyl 2-methylideneoctanoate.
Molecular Properties
| Compound Name | methyl 2-methylideneoctanoate |
| PubChem CID | 568043 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | methyl 2-methylideneoctanoate |
| SMILES | C=C(CCCCCC)C(=O)OC |
| InChI | InChI=1S/C10H18O2/c1-4-5-6-7-8-9(2)10(11)12-3/h2,4-8H2,1,3H3 |
| InChIKey | PXISPLICAYMBBX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methylideneoctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylideneoctanoate?
The IUPAC name of methyl 2-methylideneoctanoate (CID 568043) is methyl 2-methylideneoctanoate.
What is the SMILES notation for methyl 2-methylideneoctanoate?
The canonical SMILES for methyl 2-methylideneoctanoate is C=C(CCCCCC)C(=O)OC.
What is the InChIKey of methyl 2-methylideneoctanoate?
The InChIKey is PXISPLICAYMBBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-4-5-6-7-8-9(2)10(11)12-3/h2,4-8H2,1,3H3.
What are the key properties of methyl 2-methylideneoctanoate?
methyl 2-methylideneoctanoate has a molecular weight of 170.25 g/mol, XLogP of 2.69, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylideneoctanoate is sourced from PubChem (CID 568043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).