About methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate
methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate (PubChem CID 56804670) has the molecular formula C16H19ClN2O4
and a molecular weight of 338.79 g/mol. Its IUPAC name is methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate |
| PubChem CID | 56804670 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate |
| SMILES | COC(=O)CN(Cc1cc(Cl)ccc1O)Cc1c(C)noc1C |
| InChI | InChI=1S/C16H19ClN2O4/c1-10-14(11(2)23-18-10)8-19(9-16(21)22-3)7-12-6-13(17)4-5-15(12)20/h4-6,20H,7-9H2,1-3H3 |
| InChIKey | BXZOUHKDKZHHFE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate?
The IUPAC name of methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate (CID 56804670) is methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate.
What is the SMILES notation for methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate?
The canonical SMILES for methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate is COC(=O)CN(Cc1cc(Cl)ccc1O)Cc1c(C)noc1C.
What is the InChIKey of methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate?
The InChIKey is BXZOUHKDKZHHFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN2O4/c1-10-14(11(2)23-18-10)8-19(9-16(21)22-3)7-12-6-13(17)4-5-15(12)20/h4-6,20H,7-9H2,1-3H3.
What are the key properties of methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate?
methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate has a molecular weight of 338.79 g/mol, XLogP of 2.83, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate is sourced from PubChem (CID 56804670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).