C16H19ClN2O4 — CID 56804670
methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate (PubChem CID 56804670) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate.
| Compound Name | methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate |
|---|---|
| PubChem CID | 56804670 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | methyl 2-[(5-chloro-2-hydroxyphenyl)methyl-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]amino]acetate |
| SMILES | COC(=O)CN(Cc1cc(Cl)ccc1O)Cc1c(C)noc1C |
| InChI | InChI=1S/C16H19ClN2O4/c1-10-14(11(2)23-18-10)8-19(9-16(21)22-3)7-12-6-13(17)4-5-15(12)20/h4-6,20H,7-9H2,1-3H3 |
| InChIKey | BXZOUHKDKZHHFE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|