About 5-methyl-N'-[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-1H-pyrazole-4-carbohydrazide
5-methyl-N'-[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-1H-pyrazole-4-carbohydrazide (PubChem CID 56804696) has the molecular formula C15H15N5O3S
and a molecular weight of 345.38 g/mol. Its IUPAC name is 5-methyl-N'-[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-1H-pyrazole-4-carbohydrazide.
Molecular Properties
| Compound Name | 5-methyl-N'-[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-1H-pyrazole-4-carbohydrazide |
| PubChem CID | 56804696 |
| Molecular Formula | C15H15N5O3S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 5-methyl-N'-[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-1H-pyrazole-4-carbohydrazide |
| SMILES | Cc1[nH]ncc1C(=O)NNC(=O)CN1C(=O)CSc2ccccc21 |
| InChI | InChI=1S/C15H15N5O3S/c1-9-10(6-16-17-9)15(23)19-18-13(21)7-20-11-4-2-3-5-12(11)24-8-14(20)22/h2-6H,7-8H2,1H3,(H,16,17)(H,18,21)(H,19,23) |
| InChIKey | RYMLAHKILRMZMG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N'-[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-1H-pyrazole-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N'-[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-1H-pyrazole-4-carbohydrazide?
The IUPAC name of 5-methyl-N'-[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-1H-pyrazole-4-carbohydrazide (CID 56804696) is 5-methyl-N'-[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-1H-pyrazole-4-carbohydrazide.
What is the SMILES notation for 5-methyl-N'-[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-1H-pyrazole-4-carbohydrazide?
The canonical SMILES for 5-methyl-N'-[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-1H-pyrazole-4-carbohydrazide is Cc1[nH]ncc1C(=O)NNC(=O)CN1C(=O)CSc2ccccc21.
What is the InChIKey of 5-methyl-N'-[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-1H-pyrazole-4-carbohydrazide?
The InChIKey is RYMLAHKILRMZMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5O3S/c1-9-10(6-16-17-9)15(23)19-18-13(21)7-20-11-4-2-3-5-12(11)24-8-14(20)22/h2-6H,7-8H2,1H3,(H,16,17)(H,18,21)(H,19,23).
What are the key properties of 5-methyl-N'-[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-1H-pyrazole-4-carbohydrazide?
5-methyl-N'-[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-1H-pyrazole-4-carbohydrazide has a molecular weight of 345.38 g/mol, XLogP of 0.62, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N'-[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-1H-pyrazole-4-carbohydrazide is sourced from PubChem (CID 56804696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).