C17H19N3O3S — CID 56804721
3-hydroxy-N-[2-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonylamino)ethyl]pyridine-2-carboxamide (PubChem CID 56804721) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 3-hydroxy-N-[2-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonylamino)ethyl]pyridine-2-carboxamide.
| Compound Name | 3-hydroxy-N-[2-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonylamino)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 56804721 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-hydroxy-N-[2-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonylamino)ethyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1ncccc1O)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C17H19N3O3S/c21-12-5-3-7-18-15(12)17(23)20-9-8-19-16(22)14-10-11-4-1-2-6-13(11)24-14/h3,5,7,10,21H,1-2,4,6,8-9H2,(H,19,22)(H,20,23) |
| InChIKey | OZUCEPDLERQOLB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|