About tert-butyl 3,5-dimethyl-4-[3-(4-methylpyrazol-1-yl)propanoyl]piperazine-1-carboxylate
tert-butyl 3,5-dimethyl-4-[3-(4-methylpyrazol-1-yl)propanoyl]piperazine-1-carboxylate (PubChem CID 56804876) has the molecular formula C18H30N4O3
and a molecular weight of 350.46 g/mol. Its IUPAC name is tert-butyl 3,5-dimethyl-4-[3-(4-methylpyrazol-1-yl)propanoyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3,5-dimethyl-4-[3-(4-methylpyrazol-1-yl)propanoyl]piperazine-1-carboxylate |
| PubChem CID | 56804876 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | tert-butyl 3,5-dimethyl-4-[3-(4-methylpyrazol-1-yl)propanoyl]piperazine-1-carboxylate |
| SMILES | Cc1cnn(CCC(=O)N2C(C)CN(C(=O)OC(C)(C)C)CC2C)c1 |
| InChI | InChI=1S/C18H30N4O3/c1-13-9-19-21(10-13)8-7-16(23)22-14(2)11-20(12-15(22)3)17(24)25-18(4,5)6/h9-10,14-15H,7-8,11-12H2,1-6H3 |
| InChIKey | BSGDDDNAPUCLOV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 3,5-dimethyl-4-[3-(4-methylpyrazol-1-yl)propanoyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3,5-dimethyl-4-[3-(4-methylpyrazol-1-yl)propanoyl]piperazine-1-carboxylate?
The IUPAC name of tert-butyl 3,5-dimethyl-4-[3-(4-methylpyrazol-1-yl)propanoyl]piperazine-1-carboxylate (CID 56804876) is tert-butyl 3,5-dimethyl-4-[3-(4-methylpyrazol-1-yl)propanoyl]piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 3,5-dimethyl-4-[3-(4-methylpyrazol-1-yl)propanoyl]piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 3,5-dimethyl-4-[3-(4-methylpyrazol-1-yl)propanoyl]piperazine-1-carboxylate is Cc1cnn(CCC(=O)N2C(C)CN(C(=O)OC(C)(C)C)CC2C)c1.
What is the InChIKey of tert-butyl 3,5-dimethyl-4-[3-(4-methylpyrazol-1-yl)propanoyl]piperazine-1-carboxylate?
The InChIKey is BSGDDDNAPUCLOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N4O3/c1-13-9-19-21(10-13)8-7-16(23)22-14(2)11-20(12-15(22)3)17(24)25-18(4,5)6/h9-10,14-15H,7-8,11-12H2,1-6H3.
What are the key properties of tert-butyl 3,5-dimethyl-4-[3-(4-methylpyrazol-1-yl)propanoyl]piperazine-1-carboxylate?
tert-butyl 3,5-dimethyl-4-[3-(4-methylpyrazol-1-yl)propanoyl]piperazine-1-carboxylate has a molecular weight of 350.46 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3,5-dimethyl-4-[3-(4-methylpyrazol-1-yl)propanoyl]piperazine-1-carboxylate is sourced from PubChem (CID 56804876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).