C18H34N2O4 — CID 56805059
ethyl 2-methyl-2-[[2-(oxan-4-ylamino)-2-oxoethyl]amino]octanoate (PubChem CID 56805059) has the molecular formula C18H34N2O4 and a molecular weight of 342.48 g/mol. Its IUPAC name is ethyl 2-methyl-2-[[2-(oxan-4-ylamino)-2-oxoethyl]amino]octanoate.
| Compound Name | ethyl 2-methyl-2-[[2-(oxan-4-ylamino)-2-oxoethyl]amino]octanoate |
|---|---|
| PubChem CID | 56805059 |
| Molecular Formula | C18H34N2O4 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | ethyl 2-methyl-2-[[2-(oxan-4-ylamino)-2-oxoethyl]amino]octanoate |
| SMILES | CCCCCCC(C)(NCC(=O)NC1CCOCC1)C(=O)OCC |
| InChI | InChI=1S/C18H34N2O4/c1-4-6-7-8-11-18(3,17(22)24-5-2)19-14-16(21)20-15-9-12-23-13-10-15/h15,19H,4-14H2,1-3H3,(H,20,21) |
| InChIKey | NAQOUYXGZSDIIH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|