About [1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methanesulfonamide
[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methanesulfonamide (PubChem CID 56805190) has the molecular formula C13H19N5O2S
and a molecular weight of 309.40 g/mol. Its IUPAC name is [1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methanesulfonamide.
Molecular Properties
| Compound Name | [1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methanesulfonamide |
| PubChem CID | 56805190 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | [1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methanesulfonamide |
| SMILES | Cc1nnc(N2CCC(CS(N)(=O)=O)CC2)c(C#N)c1C |
| InChI | InChI=1S/C13H19N5O2S/c1-9-10(2)16-17-13(12(9)7-14)18-5-3-11(4-6-18)8-21(15,19)20/h11H,3-6,8H2,1-2H3,(H2,15,19,20) |
| InChIKey | OVJDGHKVHUWMKV-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 112.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methanesulfonamide?
The IUPAC name of [1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methanesulfonamide (CID 56805190) is [1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methanesulfonamide.
What is the SMILES notation for [1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methanesulfonamide?
The canonical SMILES for [1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methanesulfonamide is Cc1nnc(N2CCC(CS(N)(=O)=O)CC2)c(C#N)c1C.
What is the InChIKey of [1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methanesulfonamide?
The InChIKey is OVJDGHKVHUWMKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5O2S/c1-9-10(2)16-17-13(12(9)7-14)18-5-3-11(4-6-18)8-21(15,19)20/h11H,3-6,8H2,1-2H3,(H2,15,19,20).
What are the key properties of [1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methanesulfonamide?
[1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methanesulfonamide has a molecular weight of 309.40 g/mol, XLogP of 0.47, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methanesulfonamide is sourced from PubChem (CID 56805190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).