About 2,3-dimethylthiolane
2,3-dimethylthiolane (PubChem CID 568054) has the molecular formula C6H12S
and a molecular weight of 116.23 g/mol. Its IUPAC name is 2,3-dimethylthiolane.
Molecular Properties
| Compound Name | 2,3-dimethylthiolane |
| PubChem CID | 568054 |
| Molecular Formula | C6H12S |
| Molecular Weight | 116.23 g/mol |
| Exact Mass | 116.07 |
| IUPAC Name | 2,3-dimethylthiolane |
| SMILES | CC1CCSC1C |
| InChI | InChI=1S/C6H12S/c1-5-3-4-7-6(5)2/h5-6H,3-4H2,1-2H3 |
| InChIKey | PQAQKWCWCGKBDS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethylthiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylthiolane?
The IUPAC name of 2,3-dimethylthiolane (CID 568054) is 2,3-dimethylthiolane.
What is the SMILES notation for 2,3-dimethylthiolane?
The canonical SMILES for 2,3-dimethylthiolane is CC1CCSC1C.
What is the InChIKey of 2,3-dimethylthiolane?
The InChIKey is PQAQKWCWCGKBDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12S/c1-5-3-4-7-6(5)2/h5-6H,3-4H2,1-2H3.
What are the key properties of 2,3-dimethylthiolane?
2,3-dimethylthiolane has a molecular weight of 116.23 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylthiolane is sourced from PubChem (CID 568054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).