About (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 3-methylbutanoate
(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 3-methylbutanoate (PubChem CID 56805941) has the molecular formula C12H14BrN3O2
and a molecular weight of 312.17 g/mol. Its IUPAC name is (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 3-methylbutanoate.
Molecular Properties
| Compound Name | (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 3-methylbutanoate |
| PubChem CID | 56805941 |
| Molecular Formula | C12H14BrN3O2 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OCc1nc2ncc(Br)cc2[nH]1 |
| InChI | InChI=1S/C12H14BrN3O2/c1-7(2)3-11(17)18-6-10-15-9-4-8(13)5-14-12(9)16-10/h4-5,7H,3,6H2,1-2H3,(H,14,15,16) |
| InChIKey | CBUIWORHJLCJKO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 3-methylbutanoate?
The IUPAC name of (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 3-methylbutanoate (CID 56805941) is (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 3-methylbutanoate.
What is the SMILES notation for (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 3-methylbutanoate?
The canonical SMILES for (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 3-methylbutanoate is CC(C)CC(=O)OCc1nc2ncc(Br)cc2[nH]1.
What is the InChIKey of (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 3-methylbutanoate?
The InChIKey is CBUIWORHJLCJKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrN3O2/c1-7(2)3-11(17)18-6-10-15-9-4-8(13)5-14-12(9)16-10/h4-5,7H,3,6H2,1-2H3,(H,14,15,16).
What are the key properties of (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 3-methylbutanoate?
(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 3-methylbutanoate has a molecular weight of 312.17 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 3-methylbutanoate is sourced from PubChem (CID 56805941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).