C14H13N5O2S — CID 56805996
1-[2-(2-methylsulfonylbenzimidazol-1-yl)ethyl]pyrazole-4-carbonitrile (PubChem CID 56805996) has the molecular formula C14H13N5O2S and a molecular weight of 315.36 g/mol. Its IUPAC name is 1-[2-(2-methylsulfonylbenzimidazol-1-yl)ethyl]pyrazole-4-carbonitrile.
| Compound Name | 1-[2-(2-methylsulfonylbenzimidazol-1-yl)ethyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 56805996 |
| Molecular Formula | C14H13N5O2S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 1-[2-(2-methylsulfonylbenzimidazol-1-yl)ethyl]pyrazole-4-carbonitrile |
| SMILES | CS(=O)(=O)c1nc2ccccc2n1CCn1cc(C#N)cn1 |
| InChI | InChI=1S/C14H13N5O2S/c1-22(20,21)14-17-12-4-2-3-5-13(12)19(14)7-6-18-10-11(8-15)9-16-18/h2-5,9-10H,6-7H2,1H3 |
| InChIKey | DBEPJZSQXVELSZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 93.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |