C12H14F3NO4S — CID 56806428
N-methoxy-N-methyl-2-[4-(2,2,2-trifluoroethylsulfonyl)phenyl]acetamide (PubChem CID 56806428) has the molecular formula C12H14F3NO4S and a molecular weight of 325.31 g/mol. Its IUPAC name is N-methoxy-N-methyl-2-[4-(2,2,2-trifluoroethylsulfonyl)phenyl]acetamide.
| Compound Name | N-methoxy-N-methyl-2-[4-(2,2,2-trifluoroethylsulfonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 56806428 |
| Molecular Formula | C12H14F3NO4S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-methoxy-N-methyl-2-[4-(2,2,2-trifluoroethylsulfonyl)phenyl]acetamide |
| SMILES | CON(C)C(=O)Cc1ccc(S(=O)(=O)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F3NO4S/c1-16(20-2)11(17)7-9-3-5-10(6-4-9)21(18,19)8-12(13,14)15/h3-6H,7-8H2,1-2H3 |
| InChIKey | JIKYYWSPVGZRMT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|