About [3-(1,2,4-triazol-1-yl)phenyl] 3,4-difluorobenzenesulfonate
[3-(1,2,4-triazol-1-yl)phenyl] 3,4-difluorobenzenesulfonate (PubChem CID 56806439) has the molecular formula C14H9F2N3O3S
and a molecular weight of 337.31 g/mol. Its IUPAC name is [3-(1,2,4-triazol-1-yl)phenyl] 3,4-difluorobenzenesulfonate.
Molecular Properties
| Compound Name | [3-(1,2,4-triazol-1-yl)phenyl] 3,4-difluorobenzenesulfonate |
| PubChem CID | 56806439 |
| Molecular Formula | C14H9F2N3O3S |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | [3-(1,2,4-triazol-1-yl)phenyl] 3,4-difluorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1cccc(-n2cncn2)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H9F2N3O3S/c15-13-5-4-12(7-14(13)16)23(20,21)22-11-3-1-2-10(6-11)19-9-17-8-18-19/h1-9H |
| InChIKey | OANMRTWUHJDRQR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(1,2,4-triazol-1-yl)phenyl] 3,4-difluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,2,4-triazol-1-yl)phenyl] 3,4-difluorobenzenesulfonate?
The IUPAC name of [3-(1,2,4-triazol-1-yl)phenyl] 3,4-difluorobenzenesulfonate (CID 56806439) is [3-(1,2,4-triazol-1-yl)phenyl] 3,4-difluorobenzenesulfonate.
What is the SMILES notation for [3-(1,2,4-triazol-1-yl)phenyl] 3,4-difluorobenzenesulfonate?
The canonical SMILES for [3-(1,2,4-triazol-1-yl)phenyl] 3,4-difluorobenzenesulfonate is O=S(=O)(Oc1cccc(-n2cncn2)c1)c1ccc(F)c(F)c1.
What is the InChIKey of [3-(1,2,4-triazol-1-yl)phenyl] 3,4-difluorobenzenesulfonate?
The InChIKey is OANMRTWUHJDRQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F2N3O3S/c15-13-5-4-12(7-14(13)16)23(20,21)22-11-3-1-2-10(6-11)19-9-17-8-18-19/h1-9H.
What are the key properties of [3-(1,2,4-triazol-1-yl)phenyl] 3,4-difluorobenzenesulfonate?
[3-(1,2,4-triazol-1-yl)phenyl] 3,4-difluorobenzenesulfonate has a molecular weight of 337.31 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,2,4-triazol-1-yl)phenyl] 3,4-difluorobenzenesulfonate is sourced from PubChem (CID 56806439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).