C17H18ClN3O3 — CID 56806449
N'-[(4-chlorophenyl)-cyclopropylmethyl]-N-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide (PubChem CID 56806449) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is N'-[(4-chlorophenyl)-cyclopropylmethyl]-N-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide.
| Compound Name | N'-[(4-chlorophenyl)-cyclopropylmethyl]-N-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide |
|---|---|
| PubChem CID | 56806449 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N'-[(4-chlorophenyl)-cyclopropylmethyl]-N-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide |
| SMILES | Cc1noc(C)c1NC(=O)C(=O)NC(c1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C17H18ClN3O3/c1-9-14(10(2)24-21-9)19-16(22)17(23)20-15(11-3-4-11)12-5-7-13(18)8-6-12/h5-8,11,15H,3-4H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | BROQXJLSEJATRX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|