About 7-methoxy-N'-(7H-purin-6-yl)-3,4-dihydro-2H-chromene-3-carbohydrazide
7-methoxy-N'-(7H-purin-6-yl)-3,4-dihydro-2H-chromene-3-carbohydrazide (PubChem CID 56806649) has the molecular formula C16H16N6O3
and a molecular weight of 340.34 g/mol. Its IUPAC name is 7-methoxy-N'-(7H-purin-6-yl)-3,4-dihydro-2H-chromene-3-carbohydrazide.
Molecular Properties
| Compound Name | 7-methoxy-N'-(7H-purin-6-yl)-3,4-dihydro-2H-chromene-3-carbohydrazide |
| PubChem CID | 56806649 |
| Molecular Formula | C16H16N6O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 7-methoxy-N'-(7H-purin-6-yl)-3,4-dihydro-2H-chromene-3-carbohydrazide |
| SMILES | COc1ccc2c(c1)OCC(C(=O)NNc1ncnc3nc[nH]c13)C2 |
| InChI | InChI=1S/C16H16N6O3/c1-24-11-3-2-9-4-10(6-25-12(9)5-11)16(23)22-21-15-13-14(18-7-17-13)19-8-20-15/h2-3,5,7-8,10H,4,6H2,1H3,(H,22,23)(H2,17,18,19,20,21) |
| InChIKey | AMIKDLVTNGJARZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-N'-(7H-purin-6-yl)-3,4-dihydro-2H-chromene-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-N'-(7H-purin-6-yl)-3,4-dihydro-2H-chromene-3-carbohydrazide?
The IUPAC name of 7-methoxy-N'-(7H-purin-6-yl)-3,4-dihydro-2H-chromene-3-carbohydrazide (CID 56806649) is 7-methoxy-N'-(7H-purin-6-yl)-3,4-dihydro-2H-chromene-3-carbohydrazide.
What is the SMILES notation for 7-methoxy-N'-(7H-purin-6-yl)-3,4-dihydro-2H-chromene-3-carbohydrazide?
The canonical SMILES for 7-methoxy-N'-(7H-purin-6-yl)-3,4-dihydro-2H-chromene-3-carbohydrazide is COc1ccc2c(c1)OCC(C(=O)NNc1ncnc3nc[nH]c13)C2.
What is the InChIKey of 7-methoxy-N'-(7H-purin-6-yl)-3,4-dihydro-2H-chromene-3-carbohydrazide?
The InChIKey is AMIKDLVTNGJARZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N6O3/c1-24-11-3-2-9-4-10(6-25-12(9)5-11)16(23)22-21-15-13-14(18-7-17-13)19-8-20-15/h2-3,5,7-8,10H,4,6H2,1H3,(H,22,23)(H2,17,18,19,20,21).
What are the key properties of 7-methoxy-N'-(7H-purin-6-yl)-3,4-dihydro-2H-chromene-3-carbohydrazide?
7-methoxy-N'-(7H-purin-6-yl)-3,4-dihydro-2H-chromene-3-carbohydrazide has a molecular weight of 340.34 g/mol, XLogP of 1.06, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-N'-(7H-purin-6-yl)-3,4-dihydro-2H-chromene-3-carbohydrazide is sourced from PubChem (CID 56806649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).