C17H32N2O3S — CID 56806884
1-[4-[(1,1-dioxothiolan-3-yl)amino]piperidin-1-yl]octan-1-one (PubChem CID 56806884) has the molecular formula C17H32N2O3S and a molecular weight of 344.52 g/mol. Its IUPAC name is 1-[4-[(1,1-dioxothiolan-3-yl)amino]piperidin-1-yl]octan-1-one.
| Compound Name | 1-[4-[(1,1-dioxothiolan-3-yl)amino]piperidin-1-yl]octan-1-one |
|---|---|
| PubChem CID | 56806884 |
| Molecular Formula | C17H32N2O3S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-[4-[(1,1-dioxothiolan-3-yl)amino]piperidin-1-yl]octan-1-one |
| SMILES | CCCCCCCC(=O)N1CCC(NC2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C17H32N2O3S/c1-2-3-4-5-6-7-17(20)19-11-8-15(9-12-19)18-16-10-13-23(21,22)14-16/h15-16,18H,2-14H2,1H3 |
| InChIKey | PCRQVRBKWPPWRE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|