About 4-amino-3,5-dichloro-N-(2-cyanoethyl)-N-(cyclopropylmethyl)benzenesulfonamide
4-amino-3,5-dichloro-N-(2-cyanoethyl)-N-(cyclopropylmethyl)benzenesulfonamide (PubChem CID 56807006) has the molecular formula C13H15Cl2N3O2S
and a molecular weight of 348.26 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-(2-cyanoethyl)-N-(cyclopropylmethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-amino-3,5-dichloro-N-(2-cyanoethyl)-N-(cyclopropylmethyl)benzenesulfonamide |
| PubChem CID | 56807006 |
| Molecular Formula | C13H15Cl2N3O2S |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 4-amino-3,5-dichloro-N-(2-cyanoethyl)-N-(cyclopropylmethyl)benzenesulfonamide |
| SMILES | N#CCCN(CC1CC1)S(=O)(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2N3O2S/c14-11-6-10(7-12(15)13(11)17)21(19,20)18(5-1-4-16)8-9-2-3-9/h6-7,9H,1-3,5,8,17H2 |
| InChIKey | NCLZPLOAYFUHHL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3,5-dichloro-N-(2-cyanoethyl)-N-(cyclopropylmethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3,5-dichloro-N-(2-cyanoethyl)-N-(cyclopropylmethyl)benzenesulfonamide?
The IUPAC name of 4-amino-3,5-dichloro-N-(2-cyanoethyl)-N-(cyclopropylmethyl)benzenesulfonamide (CID 56807006) is 4-amino-3,5-dichloro-N-(2-cyanoethyl)-N-(cyclopropylmethyl)benzenesulfonamide.
What is the SMILES notation for 4-amino-3,5-dichloro-N-(2-cyanoethyl)-N-(cyclopropylmethyl)benzenesulfonamide?
The canonical SMILES for 4-amino-3,5-dichloro-N-(2-cyanoethyl)-N-(cyclopropylmethyl)benzenesulfonamide is N#CCCN(CC1CC1)S(=O)(=O)c1cc(Cl)c(N)c(Cl)c1.
What is the InChIKey of 4-amino-3,5-dichloro-N-(2-cyanoethyl)-N-(cyclopropylmethyl)benzenesulfonamide?
The InChIKey is NCLZPLOAYFUHHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl2N3O2S/c14-11-6-10(7-12(15)13(11)17)21(19,20)18(5-1-4-16)8-9-2-3-9/h6-7,9H,1-3,5,8,17H2.
What are the key properties of 4-amino-3,5-dichloro-N-(2-cyanoethyl)-N-(cyclopropylmethyl)benzenesulfonamide?
4-amino-3,5-dichloro-N-(2-cyanoethyl)-N-(cyclopropylmethyl)benzenesulfonamide has a molecular weight of 348.26 g/mol, XLogP of 2.89, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,5-dichloro-N-(2-cyanoethyl)-N-(cyclopropylmethyl)benzenesulfonamide is sourced from PubChem (CID 56807006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).