C22H20N4O3 — CID 56807072
3-[2-oxo-3-(4-propan-2-ylphenyl)-[1,2,4]triazino[2,3-c]quinazolin-6-yl]propanoic acid (PubChem CID 56807072) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 3-[2-oxo-3-(4-propan-2-ylphenyl)-[1,2,4]triazino[2,3-c]quinazolin-6-yl]propanoic acid.
| Compound Name | 3-[2-oxo-3-(4-propan-2-ylphenyl)-[1,2,4]triazino[2,3-c]quinazolin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 56807072 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 3-[2-oxo-3-(4-propan-2-ylphenyl)-[1,2,4]triazino[2,3-c]quinazolin-6-yl]propanoic acid |
| SMILES | CC(C)c1ccc(-c2nn3c(CCC(=O)O)nc4ccccc4c3nc2=O)cc1 |
| InChI | InChI=1S/C22H20N4O3/c1-13(2)14-7-9-15(10-8-14)20-22(29)24-21-16-5-3-4-6-17(16)23-18(26(21)25-20)11-12-19(27)28/h3-10,13H,11-12H2,1-2H3,(H,27,28) |
| InChIKey | GNBRUOVDAHEJAP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|